C22H25FN2O3S — CID 4533956
N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide (PubChem CID 4533956) has the molecular formula C22H25FN2O3S and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide.
| Compound Name | N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 4533956 |
| Molecular Formula | C22H25FN2O3S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)/N=c2\sc3cccc(F)c3n2CCOC)cc1 |
| InChI | InChI=1S/C22H25FN2O3S/c1-3-4-5-14-28-17-11-9-16(10-12-17)21(26)24-22-25(13-15-27-2)20-18(23)7-6-8-19(20)29-22/h6-12H,3-5,13-15H2,1-2H3/b24-22- |
| InChIKey | STXRSEXNJBTSKI-GYHWCHFESA-N |
| XLogP | 4.80 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|