C17H14FN3O4S — CID 4536905
N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide (PubChem CID 4536905) has the molecular formula C17H14FN3O4S and a molecular weight of 375.38 g/mol. Its IUPAC name is N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide.
| Compound Name | N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4536905 |
| Molecular Formula | C17H14FN3O4S |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-nitrobenzamide |
| SMILES | COCCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])cc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C17H14FN3O4S/c1-25-10-9-20-15-13(18)3-2-4-14(15)26-17(20)19-16(22)11-5-7-12(8-6-11)21(23)24/h2-8H,9-10H2,1H3/b19-17- |
| InChIKey | ADUFGKYJUHJPJF-ZPHPHTNESA-N |
| XLogP | 3.14 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|