C19H14FN3O4S2 — CID 4051428
N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 4051428) has the molecular formula C19H14FN3O4S2 and a molecular weight of 431.47 g/mol. Its IUPAC name is N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4051428 |
| Molecular Formula | C19H14FN3O4S2 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | N-[4-fluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | COCCn1/c(=N/C(=O)c2cc3cc([N+](=O)[O-])ccc3s2)sc2cccc(F)c21 |
| InChI | InChI=1S/C19H14FN3O4S2/c1-27-8-7-22-17-13(20)3-2-4-15(17)29-19(22)21-18(24)16-10-11-9-12(23(25)26)5-6-14(11)28-16/h2-6,9-10H,7-8H2,1H3/b21-19- |
| InChIKey | UOSHMMWWHCXMEK-VZCXRCSSSA-N |
| XLogP | 4.35 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|