C20H15F2N3O4S2 — CID 4525700
N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 4525700) has the molecular formula C20H15F2N3O4S2 and a molecular weight of 463.49 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4525700 |
| Molecular Formula | C20H15F2N3O4S2 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc3cc([N+](=O)[O-])ccc3s2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C20H15F2N3O4S2/c1-2-29-6-5-24-18-14(22)9-12(21)10-16(18)31-20(24)23-19(26)17-8-11-7-13(25(27)28)3-4-15(11)30-17/h3-4,7-10H,2,5-6H2,1H3/b23-20- |
| InChIKey | BRBBDAMBYZGYQL-ATJXCDBQSA-N |
| XLogP | 4.88 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|