C23H20F2N2O2S — CID 3430387
N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-2-naphthalen-1-ylacetamide (PubChem CID 3430387) has the molecular formula C23H20F2N2O2S and a molecular weight of 426.49 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 3430387 |
| Molecular Formula | C23H20F2N2O2S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-2-naphthalen-1-ylacetamide |
| SMILES | CCOCCn1/c(=N/C(=O)Cc2cccc3ccccc23)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C23H20F2N2O2S/c1-2-29-11-10-27-22-19(25)13-17(24)14-20(22)30-23(27)26-21(28)12-16-8-5-7-15-6-3-4-9-18(15)16/h3-9,13-14H,2,10-12H2,1H3/b26-23- |
| InChIKey | YKEZKEKRESOWIH-RWEWTDSWSA-N |
| XLogP | 4.84 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|