C20H20F2N2O3S — CID 5084718
N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-phenoxypropanamide (PubChem CID 5084718) has the molecular formula C20H20F2N2O3S and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-phenoxypropanamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 5084718 |
| Molecular Formula | C20H20F2N2O3S |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-3-phenoxypropanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCOc2ccccc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C20H20F2N2O3S/c1-2-26-11-9-24-19-16(22)12-14(21)13-17(19)28-20(24)23-18(25)8-10-27-15-6-4-3-5-7-15/h3-7,12-13H,2,8-11H2,1H3/b23-20- |
| InChIKey | YVGFEYABFYHVTI-ATJXCDBQSA-N |
| XLogP | 3.91 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|