C21H22F2N2O4S2 — CID 25406920
4-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]butanamide (PubChem CID 25406920) has the molecular formula C21H22F2N2O4S2 and a molecular weight of 468.55 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]butanamide.
| Compound Name | 4-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 25406920 |
| Molecular Formula | C21H22F2N2O4S2 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]butanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccccc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C21H22F2N2O4S2/c1-2-29-11-10-25-20-17(23)13-15(22)14-18(20)30-21(25)24-19(26)9-6-12-31(27,28)16-7-4-3-5-8-16/h3-5,7-8,13-14H,2,6,9-12H2,1H3/b24-21- |
| InChIKey | ZGWJBFACFOOUIX-FLFQWRMESA-N |
| XLogP | 3.70 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|