C20H20F2N2O4S2 — CID 42523730
2-benzylsulfonyl-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]acetamide (PubChem CID 42523730) has the molecular formula C20H20F2N2O4S2 and a molecular weight of 454.52 g/mol. Its IUPAC name is 2-benzylsulfonyl-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]acetamide.
| Compound Name | 2-benzylsulfonyl-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 42523730 |
| Molecular Formula | C20H20F2N2O4S2 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 2-benzylsulfonyl-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)CS(=O)(=O)Cc2ccccc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C20H20F2N2O4S2/c1-2-28-9-8-24-19-16(22)10-15(21)11-17(19)29-20(24)23-18(25)13-30(26,27)12-14-6-4-3-5-7-14/h3-7,10-11H,2,8-9,12-13H2,1H3/b23-20- |
| InChIKey | IHTNTPWJDBIBHL-ATJXCDBQSA-N |
| XLogP | 3.06 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|