C19H17ClF2N2O2S — CID 16912309
2-(4-chlorophenyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]acetamide (PubChem CID 16912309) has the molecular formula C19H17ClF2N2O2S and a molecular weight of 410.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 16912309 |
| Molecular Formula | C19H17ClF2N2O2S |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)Cc2ccc(Cl)cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C19H17ClF2N2O2S/c1-2-26-8-7-24-18-15(22)10-14(21)11-16(18)27-19(24)23-17(25)9-12-3-5-13(20)6-4-12/h3-6,10-11H,2,7-9H2,1H3/b23-19- |
| InChIKey | SCDVHJDJDTVBRB-NMWGTECJSA-N |
| XLogP | 4.34 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|