C22H22F2N2O2S — CID 5141715
N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 5141715) has the molecular formula C22H22F2N2O2S and a molecular weight of 416.49 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 5141715 |
| Molecular Formula | C22H22F2N2O2S |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc3c(c2)CCCC3)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C22H22F2N2O2S/c1-2-28-10-9-26-20-18(24)12-17(23)13-19(20)29-22(26)25-21(27)16-8-7-14-5-3-4-6-15(14)11-16/h7-8,11-13H,2-6,9-10H2,1H3/b25-22- |
| InChIKey | KQWCBUUYTJISJM-LVWGJNHUSA-N |
| XLogP | 4.64 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|