C22H19F2N3O4S — CID 3552836
4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 3552836) has the molecular formula C22H19F2N3O4S and a molecular weight of 459.47 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 3552836 |
| Molecular Formula | C22H19F2N3O4S |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(N3C(=O)CCC3=O)cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C22H19F2N3O4S/c1-2-31-10-9-26-20-16(24)11-14(23)12-17(20)32-22(26)25-21(30)13-3-5-15(6-4-13)27-18(28)7-8-19(27)29/h3-6,11-12H,2,7-10H2,1H3/b25-22- |
| InChIKey | OWKZKNJEDFDHJU-LVWGJNHUSA-N |
| XLogP | 3.41 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|