C16H16F2N2O4S — CID 4673508
N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 4673508) has the molecular formula C16H16F2N2O4S and a molecular weight of 370.38 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 4673508 |
| Molecular Formula | C16H16F2N2O4S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)C2=COCCO2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C16H16F2N2O4S/c1-2-22-4-3-20-14-11(18)7-10(17)8-13(14)25-16(20)19-15(21)12-9-23-5-6-24-12/h7-9H,2-6H2,1H3/b19-16- |
| InChIKey | RAJGPYZNNKLIGZ-MNDPQUGUSA-N |
| XLogP | 2.33 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|