C26H33F2N3O4S2 — CID 3432500
4-(dibutylsulfamoyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 3432500) has the molecular formula C26H33F2N3O4S2 and a molecular weight of 553.70 g/mol. Its IUPAC name is 4-(dibutylsulfamoyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-(dibutylsulfamoyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 3432500 |
| Molecular Formula | C26H33F2N3O4S2 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 4-(dibutylsulfamoyl)-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cc(F)cc(F)c3n2CCOCC)cc1 |
| InChI | InChI=1S/C26H33F2N3O4S2/c1-4-7-13-30(14-8-5-2)37(33,34)21-11-9-19(10-12-21)25(32)29-26-31(15-16-35-6-3)24-22(28)17-20(27)18-23(24)36-26/h9-12,17-18H,4-8,13-16H2,1-3H3/b29-26- |
| InChIKey | HCUHXAKICABBGX-WCTVFOPTSA-N |
| XLogP | 5.35 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|