C25H29F2N3O4S2 — CID 5181649
N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-4-(2-ethylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 5181649) has the molecular formula C25H29F2N3O4S2 and a molecular weight of 537.65 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-4-(2-ethylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-4-(2-ethylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 5181649 |
| Molecular Formula | C25H29F2N3O4S2 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]-4-(2-ethylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCCCC3CC)cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C25H29F2N3O4S2/c1-3-19-7-5-6-12-30(19)36(32,33)20-10-8-17(9-11-20)24(31)28-25-29(13-14-34-4-2)23-21(27)15-18(26)16-22(23)35-25/h8-11,15-16,19H,3-7,12-14H2,1-2H3/b28-25- |
| InChIKey | UVEDXOVAHSJYMU-FVDSYPCUSA-N |
| XLogP | 4.71 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|