C26H33Cl2N3O4S2 — CID 43939423
4-(dibutylsulfamoyl)-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 43939423) has the molecular formula C26H33Cl2N3O4S2 and a molecular weight of 586.61 g/mol. Its IUPAC name is 4-(dibutylsulfamoyl)-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-(dibutylsulfamoyl)-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 43939423 |
| Molecular Formula | C26H33Cl2N3O4S2 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | 4-(dibutylsulfamoyl)-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3ccc(Cl)c(Cl)c3n2CCOCC)cc1 |
| InChI | InChI=1S/C26H33Cl2N3O4S2/c1-4-7-15-30(16-8-5-2)37(33,34)20-11-9-19(10-12-20)25(32)29-26-31(17-18-35-6-3)24-22(36-26)14-13-21(27)23(24)28/h9-14H,4-8,15-18H2,1-3H3/b29-26- |
| InChIKey | GRGZIORBOSKJLP-WCTVFOPTSA-N |
| XLogP | 6.38 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|