C23H29N3O4S2 — CID 41202390
4-(diethylsulfamoyl)-N-[3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 41202390) has the molecular formula C23H29N3O4S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 41202390 |
| Molecular Formula | C23H29N3O4S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CC)CC)cc2)sc2cccc(C)c21 |
| InChI | InChI=1S/C23H29N3O4S2/c1-5-25(6-2)32(28,29)19-13-11-18(12-14-19)22(27)24-23-26(15-16-30-7-3)21-17(4)9-8-10-20(21)31-23/h8-14H,5-7,15-16H2,1-4H3/b24-23- |
| InChIKey | DXQAXMKFJABQRC-VHXPQNKSSA-N |
| XLogP | 3.82 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|