C28H31N3O5S2 — CID 43939445
4-[benzyl(methyl)sulfamoyl]-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 43939445) has the molecular formula C28H31N3O5S2 and a molecular weight of 553.71 g/mol. Its IUPAC name is 4-[benzyl(methyl)sulfamoyl]-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-[benzyl(methyl)sulfamoyl]-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 43939445 |
| Molecular Formula | C28H31N3O5S2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 4-[benzyl(methyl)sulfamoyl]-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(C)Cc3ccccc3)cc2)sc2cccc(OCC)c21 |
| InChI | InChI=1S/C28H31N3O5S2/c1-4-35-19-18-31-26-24(36-5-2)12-9-13-25(26)37-28(31)29-27(32)22-14-16-23(17-15-22)38(33,34)30(3)20-21-10-7-6-8-11-21/h6-17H,4-5,18-20H2,1-3H3/b29-28- |
| InChIKey | HXAUEQKBSFAVBP-ZIADKAODSA-N |
| XLogP | 4.70 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|