C20H20Cl2N2O3S — CID 41202522
3,5-dichloro-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 41202522) has the molecular formula C20H20Cl2N2O3S and a molecular weight of 439.36 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 3,5-dichloro-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 41202522 |
| Molecular Formula | C20H20Cl2N2O3S |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 3,5-dichloro-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(Cl)cc(Cl)c2)sc2cccc(OCC)c21 |
| InChI | InChI=1S/C20H20Cl2N2O3S/c1-3-26-9-8-24-18-16(27-4-2)6-5-7-17(18)28-20(24)23-19(25)13-10-14(21)12-15(22)11-13/h5-7,10-12H,3-4,8-9H2,1-2H3/b23-20- |
| InChIKey | AQNXKJIPESPXHV-ATJXCDBQSA-N |
| XLogP | 5.19 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|