C21H22Cl2N2O4S — CID 41202935
2-(2,4-dichlorophenoxy)-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]acetamide (PubChem CID 41202935) has the molecular formula C21H22Cl2N2O4S and a molecular weight of 469.39 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 41202935 |
| Molecular Formula | C21H22Cl2N2O4S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)COc2ccc(Cl)cc2Cl)sc2cccc(OCC)c21 |
| InChI | InChI=1S/C21H22Cl2N2O4S/c1-3-27-11-10-25-20-17(28-4-2)6-5-7-18(20)30-21(25)24-19(26)13-29-16-9-8-14(22)12-15(16)23/h5-9,12H,3-4,10-11,13H2,1-2H3/b24-21- |
| InChIKey | WHBCYZXFDKBYIB-FLFQWRMESA-N |
| XLogP | 4.95 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|