C21H22Cl2N2O3S — CID 41202941
2-(2,4-dichlorophenoxy)-N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]acetamide (PubChem CID 41202941) has the molecular formula C21H22Cl2N2O3S and a molecular weight of 453.39 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 41202941 |
| Molecular Formula | C21H22Cl2N2O3S |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)COc2ccc(Cl)cc2Cl)sc2cc(C)cc(C)c21 |
| InChI | InChI=1S/C21H22Cl2N2O3S/c1-4-27-8-7-25-20-14(3)9-13(2)10-18(20)29-21(25)24-19(26)12-28-17-6-5-15(22)11-16(17)23/h5-6,9-11H,4,7-8,12H2,1-3H3/b24-21- |
| InChIKey | QLUZOFMSILHATI-FLFQWRMESA-N |
| XLogP | 5.17 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|