C20H21IN2O2S — CID 43939395
N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-2-iodobenzamide (PubChem CID 43939395) has the molecular formula C20H21IN2O2S and a molecular weight of 480.37 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-2-iodobenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-2-iodobenzamide |
|---|---|
| PubChem CID | 43939395 |
| Molecular Formula | C20H21IN2O2S |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-2-iodobenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccccc2I)sc2cc(C)cc(C)c21 |
| InChI | InChI=1S/C20H21IN2O2S/c1-4-25-10-9-23-18-14(3)11-13(2)12-17(18)26-20(23)22-19(24)15-7-5-6-8-16(15)21/h5-8,11-12H,4,9-10H2,1-3H3/b22-20- |
| InChIKey | IEIMNDRGGOHIGK-XDOYNYLZSA-N |
| XLogP | 4.70 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|