C17H17N3O4S2 — CID 7152940
N-[3-(2-methoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-5-nitrothiophene-2-carboxamide (PubChem CID 7152940) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[3-(2-methoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7152940 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-[3-(2-methoxyethyl)-4,6-dimethyl-1,3-benzothiazol-2-ylidene]-5-nitrothiophene-2-carboxamide |
| SMILES | COCCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])s2)sc2cc(C)cc(C)c21 |
| InChI | InChI=1S/C17H17N3O4S2/c1-10-8-11(2)15-13(9-10)26-17(19(15)6-7-24-3)18-16(21)12-4-5-14(25-12)20(22)23/h4-5,8-9H,6-7H2,1-3H3/b18-17- |
| InChIKey | MKBHZPCRZBOJSG-ZCXUNETKSA-N |
| XLogP | 3.68 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|