C15H9Cl2N3O5S2 — CID 41204712
methyl 2-[4,6-dichloro-2-(5-nitrothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 41204712) has the molecular formula C15H9Cl2N3O5S2 and a molecular weight of 446.29 g/mol. Its IUPAC name is methyl 2-[4,6-dichloro-2-(5-nitrothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[4,6-dichloro-2-(5-nitrothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41204712 |
| Molecular Formula | C15H9Cl2N3O5S2 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 444.94 |
| IUPAC Name | methyl 2-[4,6-dichloro-2-(5-nitrothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2ccc([N+](=O)[O-])s2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C15H9Cl2N3O5S2/c1-25-12(21)6-19-13-8(17)4-7(16)5-10(13)27-15(19)18-14(22)9-2-3-11(26-9)20(23)24/h2-5H,6H2,1H3/b18-15- |
| InChIKey | KPTWQWSNGBPACU-SDXDJHTJSA-N |
| XLogP | 3.89 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|