C16H11Cl2N3O3S — CID 40885347
N-(4,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide (PubChem CID 40885347) has the molecular formula C16H11Cl2N3O3S and a molecular weight of 396.26 g/mol. Its IUPAC name is N-(4,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide.
| Compound Name | N-(4,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide |
|---|---|
| PubChem CID | 40885347 |
| Molecular Formula | C16H11Cl2N3O3S |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | N-(4,6-dichloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-nitrobenzamide |
| SMILES | CCn1/c(=N/C(=O)c2ccccc2[N+](=O)[O-])sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C16H11Cl2N3O3S/c1-2-20-14-11(18)7-9(17)8-13(14)25-16(20)19-15(22)10-5-3-4-6-12(10)21(23)24/h3-8H,2H2,1H3/b19-16- |
| InChIKey | NMERFCLAHLZNEL-MNDPQUGUSA-N |
| XLogP | 4.68 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|