C16H12Cl2N2OS — CID 4187487
2-chloro-N-(4-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 4187487) has the molecular formula C16H12Cl2N2OS and a molecular weight of 351.26 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 2-chloro-N-(4-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 4187487 |
| Molecular Formula | C16H12Cl2N2OS |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 2-chloro-N-(4-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | CCn1/c(=N/C(=O)c2ccccc2Cl)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C16H12Cl2N2OS/c1-2-20-14-12(18)8-5-9-13(14)22-16(20)19-15(21)10-6-3-4-7-11(10)17/h3-9H,2H2,1H3/b19-16- |
| InChIKey | IQZYYWCEDFSDKP-MNDPQUGUSA-N |
| XLogP | 4.77 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |