C15H10ClIN2OS — CID 2104662
N-(4-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-iodobenzamide (PubChem CID 2104662) has the molecular formula C15H10ClIN2OS and a molecular weight of 428.68 g/mol. Its IUPAC name is N-(4-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-iodobenzamide.
| Compound Name | N-(4-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-iodobenzamide |
|---|---|
| PubChem CID | 2104662 |
| Molecular Formula | C15H10ClIN2OS |
| Molecular Weight | 428.68 g/mol |
| Exact Mass | 427.92 |
| IUPAC Name | N-(4-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-iodobenzamide |
| SMILES | Cn1/c(=N/C(=O)c2ccccc2I)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C15H10ClIN2OS/c1-19-13-10(16)6-4-8-12(13)21-15(19)18-14(20)9-5-2-3-7-11(9)17/h2-8H,1H3/b18-15- |
| InChIKey | SREMLEKMSXLNOB-SDXDJHTJSA-N |
| XLogP | 4.24 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|