C17H10FIN2OS — CID 5046210
N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-iodobenzamide (PubChem CID 5046210) has the molecular formula C17H10FIN2OS and a molecular weight of 436.25 g/mol. Its IUPAC name is N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-iodobenzamide.
| Compound Name | N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-iodobenzamide |
|---|---|
| PubChem CID | 5046210 |
| Molecular Formula | C17H10FIN2OS |
| Molecular Weight | 436.25 g/mol |
| Exact Mass | 435.95 |
| IUPAC Name | N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-iodobenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccccc2I)sc2cccc(F)c21 |
| InChI | InChI=1S/C17H10FIN2OS/c1-2-10-21-15-12(18)7-5-9-14(15)23-17(21)20-16(22)11-6-3-4-8-13(11)19/h1,3-9H,10H2/b20-17- |
| InChIKey | CSUFSRFWBPCDAP-JZJYNLBNSA-N |
| XLogP | 3.82 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|