C16H12FN3OS2 — CID 43945863
N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 43945863) has the molecular formula C16H12FN3OS2 and a molecular weight of 345.42 g/mol. Its IUPAC name is N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 43945863 |
| Molecular Formula | C16H12FN3OS2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2sc(C)nc2C)sc2cccc(F)c21 |
| InChI | InChI=1S/C16H12FN3OS2/c1-4-8-20-13-11(17)6-5-7-12(13)23-16(20)19-15(21)14-9(2)18-10(3)22-14/h1,5-7H,8H2,2-3H3/b19-16- |
| InChIKey | VMASNWSJOLVKHA-MNDPQUGUSA-N |
| XLogP | 3.29 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|