C16H15FN2OS — CID 43945329
N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)cyclopentanecarboxamide (PubChem CID 43945329) has the molecular formula C16H15FN2OS and a molecular weight of 302.37 g/mol. Its IUPAC name is N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)cyclopentanecarboxamide.
| Compound Name | N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 43945329 |
| Molecular Formula | C16H15FN2OS |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)cyclopentanecarboxamide |
| SMILES | C#CCn1/c(=N/C(=O)C2CCCC2)sc2cccc(F)c21 |
| InChI | InChI=1S/C16H15FN2OS/c1-2-10-19-14-12(17)8-5-9-13(14)21-16(19)18-15(20)11-6-3-4-7-11/h1,5,8-9,11H,3-4,6-7,10H2/b18-16- |
| InChIKey | ZLUVRVMKGQEQKT-VLGSPTGOSA-N |
| XLogP | 3.09 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|