C19H22N2OS — CID 43946166
N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)cyclohexanecarboxamide (PubChem CID 43946166) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)cyclohexanecarboxamide.
| Compound Name | N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 43946166 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-(4,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)cyclohexanecarboxamide |
| SMILES | C#CCn1/c(=N/C(=O)C2CCCCC2)sc2cc(C)cc(C)c21 |
| InChI | InChI=1S/C19H22N2OS/c1-4-10-21-17-14(3)11-13(2)12-16(17)23-19(21)20-18(22)15-8-6-5-7-9-15/h1,11-12,15H,5-10H2,2-3H3/b20-19- |
| InChIKey | NPFLTNCSXUZMSR-VXPUYCOJSA-N |
| XLogP | 3.96 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|