C19H12FN3O3S — CID 40654884
(Z)-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 40654884) has the molecular formula C19H12FN3O3S and a molecular weight of 381.39 g/mol. Its IUPAC name is (Z)-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 40654884 |
| Molecular Formula | C19H12FN3O3S |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | (Z)-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | C#CCn1/c(=N/C(=O)/C=C\c2ccc([N+](=O)[O-])cc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C19H12FN3O3S/c1-2-12-22-18-15(20)4-3-5-16(18)27-19(22)21-17(24)11-8-13-6-9-14(10-7-13)23(25)26/h1,3-11H,12H2/b11-8-,21-19- |
| InChIKey | KMTDVSCFKIPKRD-DBEZYPEISA-N |
| XLogP | 3.52 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|