C19H15FN2OS2 — CID 42523518
2-benzylsulfanyl-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 42523518) has the molecular formula C19H15FN2OS2 and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-benzylsulfanyl-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 42523518 |
| Molecular Formula | C19H15FN2OS2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-benzylsulfanyl-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C#CCn1/c(=N/C(=O)CSCc2ccccc2)sc2cccc(F)c21 |
| InChI | InChI=1S/C19H15FN2OS2/c1-2-11-22-18-15(20)9-6-10-16(18)25-19(22)21-17(23)13-24-12-14-7-4-3-5-8-14/h1,3-10H,11-13H2/b21-19- |
| InChIKey | BPCKYEDRJZRQIV-VZCXRCSSSA-N |
| XLogP | 3.84 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|