C21H15FN2O3S — CID 40889892
7-ethoxy-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-benzofuran-2-carboxamide (PubChem CID 40889892) has the molecular formula C21H15FN2O3S and a molecular weight of 394.43 g/mol. Its IUPAC name is 7-ethoxy-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-benzofuran-2-carboxamide.
| Compound Name | 7-ethoxy-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 40889892 |
| Molecular Formula | C21H15FN2O3S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 7-ethoxy-N-(4-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-benzofuran-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc3cccc(OCC)c3o2)sc2cccc(F)c21 |
| InChI | InChI=1S/C21H15FN2O3S/c1-3-11-24-18-14(22)8-6-10-17(18)28-21(24)23-20(25)16-12-13-7-5-9-15(26-4-2)19(13)27-16/h1,5-10,12H,4,11H2,2H3/b23-21- |
| InChIKey | GVBYVBWHEPULHS-LNVKXUELSA-N |
| XLogP | 4.36 |
| TPSA | 56.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|