C23H20N2O3S — CID 40889959
N-(5,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-7-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 40889959) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-(5,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-7-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-(5,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-7-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 40889959 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-(5,6-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-7-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc3cccc(OCC)c3o2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C23H20N2O3S/c1-5-10-25-17-11-14(3)15(4)12-20(17)29-23(25)24-22(26)19-13-16-8-7-9-18(27-6-2)21(16)28-19/h1,7-9,11-13H,6,10H2,2-4H3/b24-23- |
| InChIKey | UPBBOTXMOFBVPJ-VHXPQNKSSA-N |
| XLogP | 4.84 |
| TPSA | 56.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|