C24H26N2O6S — CID 40889930
7-ethoxy-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-1-benzofuran-2-carboxamide (PubChem CID 40889930) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is 7-ethoxy-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-1-benzofuran-2-carboxamide.
| Compound Name | 7-ethoxy-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 40889930 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 7-ethoxy-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-1-benzofuran-2-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc3cccc(OCC)c3o2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C24H26N2O6S/c1-5-30-11-10-26-16-13-18(28-3)19(29-4)14-21(16)33-24(26)25-23(27)20-12-15-8-7-9-17(31-6-2)22(15)32-20/h7-9,12-14H,5-6,10-11H2,1-4H3/b25-24- |
| InChIKey | LFIKZGQCEWZVCX-IZHYLOQSSA-N |
| XLogP | 4.64 |
| TPSA | 84.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|