C24H26N2O4S — CID 40889961
7-ethoxy-N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-1-benzofuran-2-carboxamide (PubChem CID 40889961) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 7-ethoxy-N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-1-benzofuran-2-carboxamide.
| Compound Name | 7-ethoxy-N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 40889961 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 7-ethoxy-N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-1-benzofuran-2-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc3cccc(OCC)c3o2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C24H26N2O4S/c1-5-28-11-10-26-18-12-15(3)16(4)13-21(18)31-24(26)25-23(27)20-14-17-8-7-9-19(29-6-2)22(17)30-20/h7-9,12-14H,5-6,10-11H2,1-4H3/b25-24- |
| InChIKey | MXWFTLVGBAXTTL-IZHYLOQSSA-N |
| XLogP | 5.24 |
| TPSA | 65.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|