C23H28N2O5S — CID 41102163
N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-3,4,5-trimethoxybenzamide (PubChem CID 41102163) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 41102163 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-3,4,5-trimethoxybenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(OC)c(OC)c(OC)c2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C23H28N2O5S/c1-7-30-9-8-25-17-10-14(2)15(3)11-20(17)31-23(25)24-22(26)16-12-18(27-4)21(29-6)19(13-16)28-5/h10-13H,7-9H2,1-6H3/b24-23- |
| InChIKey | POFVFJRYAQFGIX-VHXPQNKSSA-N |
| XLogP | 4.12 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|