C22H16N2O5S — CID 40889923
7-ethoxy-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1-benzofuran-2-carboxamide (PubChem CID 40889923) has the molecular formula C22H16N2O5S and a molecular weight of 420.45 g/mol. Its IUPAC name is 7-ethoxy-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1-benzofuran-2-carboxamide.
| Compound Name | 7-ethoxy-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 40889923 |
| Molecular Formula | C22H16N2O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 7-ethoxy-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1-benzofuran-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc3cccc(OCC)c3o2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C22H16N2O5S/c1-3-8-24-14-10-16-17(28-12-27-16)11-19(14)30-22(24)23-21(25)18-9-13-6-5-7-15(26-4-2)20(13)29-18/h1,5-7,9-11H,4,8,12H2,2H3/b23-22- |
| InChIKey | ZJTWWUQPZXLGBI-FCQUAONHSA-N |
| XLogP | 3.95 |
| TPSA | 75.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|