C21H14N2O5S — CID 40889706
7-methoxy-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1-benzofuran-2-carboxamide (PubChem CID 40889706) has the molecular formula C21H14N2O5S and a molecular weight of 406.42 g/mol. Its IUPAC name is 7-methoxy-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 40889706 |
| Molecular Formula | C21H14N2O5S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 7-methoxy-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)-1-benzofuran-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc3cccc(OC)c3o2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C21H14N2O5S/c1-3-7-23-13-9-15-16(27-11-26-15)10-18(13)29-21(23)22-20(24)17-8-12-5-4-6-14(25-2)19(12)28-17/h1,4-6,8-10H,7,11H2,2H3/b22-21- |
| InChIKey | LTJGDOKJMIVSNN-DQRAZIAOSA-N |
| XLogP | 3.56 |
| TPSA | 75.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|