C23H22N2O5S — CID 40889927
N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-7-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 40889927) has the molecular formula C23H22N2O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-7-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-7-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 40889927 |
| Molecular Formula | C23H22N2O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-(5,6-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-7-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc3cccc(OCC)c3o2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C23H22N2O5S/c1-5-10-25-15-12-17(27-3)18(28-4)13-20(15)31-23(25)24-22(26)19-11-14-8-7-9-16(29-6-2)21(14)30-19/h5,7-9,11-13H,1,6,10H2,2-4H3/b24-23- |
| InChIKey | MXKFIGIKIFGRGX-VHXPQNKSSA-N |
| XLogP | 4.79 |
| TPSA | 75.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|