C24H22N2O3S — CID 4121901
N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methoxynaphthalene-2-carboxamide (PubChem CID 4121901) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 4121901 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methoxynaphthalene-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc3ccccc3cc2OC)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C24H22N2O3S/c1-4-12-26-20-11-10-18(29-5-2)15-22(20)30-24(26)25-23(27)19-13-16-8-6-7-9-17(16)14-21(19)28-3/h4,6-11,13-15H,1,5,12H2,2-3H3/b25-24- |
| InChIKey | WERIXKWGTSEJDN-IZHYLOQSSA-N |
| XLogP | 5.19 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|