C23H26N2O3S — CID 3645274
4-butoxy-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 3645274) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-butoxy-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-butoxy-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 3645274 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-butoxy-N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(OCCCC)cc2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C23H26N2O3S/c1-4-7-15-28-18-10-8-17(9-11-18)22(26)24-23-25(14-5-2)20-13-12-19(27-6-3)16-21(20)29-23/h5,8-13,16H,2,4,6-7,14-15H2,1,3H3/b24-23- |
| InChIKey | SKTGSGVKMXRTEF-VHXPQNKSSA-N |
| XLogP | 5.21 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|