C21H24N2O4S — CID 4105205
N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-methoxybenzamide (PubChem CID 4105205) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-methoxybenzamide.
| Compound Name | N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4105205 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-methoxybenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccccc2OC)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C21H24N2O4S/c1-4-26-13-12-23-17-11-10-15(27-5-2)14-19(17)28-21(23)22-20(24)16-8-6-7-9-18(16)25-3/h6-11,14H,4-5,12-13H2,1-3H3/b22-21- |
| InChIKey | AVRXLJFVRIHNFH-DQRAZIAOSA-N |
| XLogP | 3.89 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|