C19H18Cl2N2O3S — CID 43937272
5-chloro-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-methoxybenzamide (PubChem CID 43937272) has the molecular formula C19H18Cl2N2O3S and a molecular weight of 425.34 g/mol. Its IUPAC name is 5-chloro-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-methoxybenzamide |
|---|---|
| PubChem CID | 43937272 |
| Molecular Formula | C19H18Cl2N2O3S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 5-chloro-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-methoxybenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(Cl)ccc2OC)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H18Cl2N2O3S/c1-3-26-9-8-23-15-6-4-13(21)11-17(15)27-19(23)22-18(24)14-10-12(20)5-7-16(14)25-2/h4-7,10-11H,3,8-9H2,1-2H3/b22-19- |
| InChIKey | SXVQVZRZMVOULI-QOCHGBHMSA-N |
| XLogP | 4.80 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|