C20H20Cl2N2O4S — CID 41092085
2,4-dichloro-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 41092085) has the molecular formula C20H20Cl2N2O4S and a molecular weight of 455.36 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 2,4-dichloro-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 41092085 |
| Molecular Formula | C20H20Cl2N2O4S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 2,4-dichloro-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(Cl)cc2Cl)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C20H20Cl2N2O4S/c1-4-28-8-7-24-15-10-16(26-2)17(27-3)11-18(15)29-20(24)23-19(25)13-6-5-12(21)9-14(13)22/h5-6,9-11H,4,7-8H2,1-3H3/b23-20- |
| InChIKey | FILIQNATFDMTBS-ATJXCDBQSA-N |
| XLogP | 4.80 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|