C22H21ClN2O4S2 — CID 41092359
3-chloro-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-1-benzothiophene-2-carboxamide (PubChem CID 41092359) has the molecular formula C22H21ClN2O4S2 and a molecular weight of 477.01 g/mol. Its IUPAC name is 3-chloro-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 41092359 |
| Molecular Formula | C22H21ClN2O4S2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 3-chloro-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-1-benzothiophene-2-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2sc3ccccc3c2Cl)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C22H21ClN2O4S2/c1-4-29-10-9-25-14-11-15(27-2)16(28-3)12-18(14)31-22(25)24-21(26)20-19(23)13-7-5-6-8-17(13)30-20/h5-8,11-12H,4,9-10H2,1-3H3/b24-22- |
| InChIKey | UWMNZYRLYLFIAQ-GYHWCHFESA-N |
| XLogP | 5.37 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|