C20H21N3O6S — CID 18572828
N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-2-nitrobenzamide (PubChem CID 18572828) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-2-nitrobenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-2-nitrobenzamide |
|---|---|
| PubChem CID | 18572828 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-2-nitrobenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccccc2[N+](=O)[O-])sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C20H21N3O6S/c1-4-29-10-9-22-15-11-16(27-2)17(28-3)12-18(15)30-20(22)21-19(24)13-7-5-6-8-14(13)23(25)26/h5-8,11-12H,4,9-10H2,1-3H3/b21-20- |
| InChIKey | LVYYJMYBQMQXCZ-MRCUWXFGSA-N |
| XLogP | 3.41 |
| TPSA | 105.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|