C20H21N3O5S — CID 43937513
N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-methyl-3-nitrobenzamide (PubChem CID 43937513) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43937513 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-methyl-3-nitrobenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cccc([N+](=O)[O-])c2C)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C20H21N3O5S/c1-4-28-11-10-22-17-9-8-14(27-3)12-18(17)29-20(22)21-19(24)15-6-5-7-16(13(15)2)23(25)26/h5-9,12H,4,10-11H2,1-3H3/b21-20- |
| InChIKey | NEEBYGFOUCQYLO-MRCUWXFGSA-N |
| XLogP | 3.71 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|