C20H22N2O5S2 — CID 16799622
N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-methylsulfonylbenzamide (PubChem CID 16799622) has the molecular formula C20H22N2O5S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-methylsulfonylbenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 16799622 |
| Molecular Formula | C20H22N2O5S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-methoxy-1,3-benzothiazol-2-ylidene]-2-methylsulfonylbenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccccc2S(C)(=O)=O)sc2cc(OC)ccc21 |
| InChI | InChI=1S/C20H22N2O5S2/c1-4-27-12-11-22-16-10-9-14(26-2)13-17(16)28-20(22)21-19(23)15-7-5-6-8-18(15)29(3,24)25/h5-10,13H,4,11-12H2,1-3H3/b21-20- |
| InChIKey | PVGCPMHLLNNBKC-MRCUWXFGSA-N |
| XLogP | 2.89 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|