C21H24N2O6S2 — CID 3560514
N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-3,5-dimethoxybenzamide (PubChem CID 3560514) has the molecular formula C21H24N2O6S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-3,5-dimethoxybenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 3560514 |
| Molecular Formula | C21H24N2O6S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-3,5-dimethoxybenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(OC)cc(OC)c2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H24N2O6S2/c1-5-29-9-8-23-18-7-6-17(31(4,25)26)13-19(18)30-21(23)22-20(24)14-10-15(27-2)12-16(11-14)28-3/h6-7,10-13H,5,8-9H2,1-4H3/b22-21- |
| InChIKey | AAEJZWWKWBALHB-DQRAZIAOSA-N |
| XLogP | 2.90 |
| TPSA | 96.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|